| Name |
Podecdysone B |
| Formula |
C27H42O6 |
| Mw |
462.29813907 |
| CAS RN |
22612-27-7 |
| C_ID |
C00003664
, 
|
| InChIKey |
AEFMTBQZWMUASH-PMJZNYMYNA-N |
| InChICode |
InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)22-7-6-16-15-12-19(28)18-13-20(29)21(30)14-26(18,4)17(15)8-11-25(16,22)3/h6,18,20-23,29-33H,7-14H2,1-5H3/t18-,20+,21-,22-,23+,25-,26+,27+/m0/s1 |
| SMILES |
CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)C[C@H](O)[C@H](O)C[C@H]1C(=O)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Podocarpaceae | Podocarpus sp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
|
|
zoom in
| Organism | Podocarpus sp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|