| Name |
Glycyrrhizic acid Glycyrrhizin |
| Formula |
C42H62O16 |
| Mw |
822.40378593 |
| CAS RN |
1405-86-3 |
| C_ID |
C00003522
, 
|
| InChIKey |
LPLVUJXQOOQHMX-ZSAZCZJXNA-N |
| InChICode |
InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28+,29+,30+,31+,34-,35-,38+,39-,40-,41+,42+/m0/s1 |
| SMILES |
CC1(C)[C@@H](O[C@@H]2OC(C(=O)O)[C@@H](O)[C@H](O)C2O[C@@H]2OC(C(=O)O)[C@@H](O)[C@H](O)C2O)CC[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Fabaceae | Abrus precatorius  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza radix | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Stevia rebaudiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|