| Name |
Phorbol |
| Formula |
C20H28O6 |
| Mw |
364.18858863 |
| CAS RN |
17673-25-5 |
| C_ID |
C00003465
, 
|
| InChIKey |
QGVLYPPODPLXMB-VWVSKLTQNA-N |
| InChICode |
InChI=1S/C20H28O6/c1-9-5-13-18(24,15(9)22)7-11(8-21)6-12-14-17(3,4)20(14,26)16(23)10(2)19(12,13)25/h5-6,10,12-14,16,21,23-26H,7-8H2,1-4H3/t10-,12-,13-,14-,16-,18-,19+,20-/m1/s1 |
| SMILES |
CC1=C[C@H]2[C@@]3(O)[C@H](C)[C@@H](O)[C@]4(O)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Lychnis dioica | Ref. |
| Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
| Plantae | Taxodiaceae | Sequoia gigantea | Ref. |
| Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
| - | - | Alliun cepa | Ref. |
|
|
zoom in
| Organism | Lychnis dioica |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
