| Name |
Ingenol |
| Formula |
C20H28O5 |
| Mw |
348.193674 |
| CAS RN |
30220-46-3 |
| C_ID |
C00003439
, 
|
| InChIKey |
VEBVPUXQAPLADL-ZYHKUOBGNA-N |
| InChICode |
InChI=1S/C20H28O5/c1-9-7-19-10(2)5-13-14(18(13,3)4)12(17(19)24)6-11(8-21)16(23)20(19,25)15(9)22/h6-7,10,12-16,21-23,25H,5,8H2,1-4H3/t10-,12-,13-,14-,15+,16-,19-,20-/m1/s1 |
| SMILES |
CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1O)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia esula | Ref. |
| Plantae | Euphorbiaceae | Euphorbia seguieriana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia spp. | Ref. |
|
|
zoom in
| Organism | Euphorbia esula | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|