| Name |
Xanthatin |
| Formula |
C15H18O3 |
| Mw |
246.12559444 |
| CAS RN |
26791-73-1 |
| C_ID |
C00003394
, 
|
| InChIKey |
RBRPTFMVULVGIC-HWRQIWQWNA-N |
| InChICode |
InChI=1S/C15H18O3/c1-9-8-14-13(11(3)15(17)18-14)7-6-12(9)5-4-10(2)16/h4-6,9,13-14H,3,7-8H2,1-2H3/b5-4+/t9-,13+,14-/m0/s1 |
| SMILES |
C=C1C(=O)O[C@H]2C[C@H](C)C(/C=C/C(C)=O)=CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Xanthium pennsylvanicum | Ref. |
| Plantae | Asteraceae | Xanthium pensylvanicum | Ref. |
| Plantae | Asteraceae | Xanthium riparium | Ref. |
| Plantae | Asteraceae | Xanthium sibiricum  | Ref. |
|
|
zoom in
| Organism | Xanthium pennsylvanicum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|