| Name |
Ridentin
Ridentin A |
| Formula |
C15H20O4 |
| Mw |
264.13615913 |
| CAS RN |
28148-84-7 |
| C_ID |
C00003361
, 
|
| InChIKey |
KQCHEWVHXSAJIA-WSFHHYJONA-N |
| InChICode |
InChI=1S/C15H20O4/c1-8-4-5-11-10(3)15(18)19-14(11)6-9(2)13(17)7-12(8)16/h6,11-14,16-17H,1,3-5,7H2,2H3/b9-6+/t11-,12+,13-,14-/m0/s1 |
| SMILES |
C=C1CC[C@H]2C(=C)C(=O)O[C@@H]2/C=C(C)[C@@H](O)C[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Asteraceae | Artemisia cana | Ref. |
| Plantae | Asteraceae | Artemisia gorgonum | Ref. |
| Plantae | Asteraceae | Artemisia tridentata | Ref. |
| Plantae | Asteraceae | Artemisia tripartita | Ref. |
|
|
zoom in
| Organism | Artemisia argyi |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
