| Name |
Provincialin |
| Formula |
C27H34O10 |
| Mw |
518.21519731 |
| CAS RN |
40328-96-9 |
| C_ID |
C00003354
, 
|
| InChIKey |
RQCXPCGOVWKZCE-DIVWTXDONA-N |
| InChICode |
InChI=1S/C27H34O10/c1-6-19(13-29)26(32)34-14-20(9-10-28)27(33)37-22-11-15(2)7-8-21(35-18(5)30)16(3)12-23-24(22)17(4)25(31)36-23/h6-7,9,12,21-24,28-29H,4,8,10-11,13-14H2,1-3,5H3/b15-7+,16-12-,19-6+,20-9+/t21-,22+,23-,24+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2/C=C(/C)[C@@H](OC(C)=O)C/C=C(C)C[C@@H](OC(=O)/C(=C/CO)COC(=O)/C(=C/C)CO)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina anisochroma | Ref. |
| Plantae | Asteraceae | Liatris provincialis | Ref. |
|
|
zoom in
| Organism | Ageratina anisochroma | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|