| Name |
Orizabin |
| Formula |
C19H26O7 |
| Mw |
366.16785319 |
| CAS RN |
34367-14-1 |
| C_ID |
C00003342
, 
|
| InChIKey |
RHVYFOFKEZHFKR-LRPZDRCVNA-N |
| InChICode |
InChI=1S/C19H26O7/c1-9(2)16(21)25-13-7-18(5)14(20)8-19(23,26-18)10(3)6-12-15(13)11(4)17(22)24-12/h6,9,12-15,20,23H,4,7-8H2,1-3,5H3/b10-6-/t12-,13+,14-,15-,18+,19+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2/C=C(/C)[C@@]3(O)C[C@H](O)[C@@](C)(C[C@@H](OC(=O)C(C)C)[C@@H]12)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tithonia tagiliflora | Ref. |
| Plantae | Asteraceae | Tithonia tagitiflora | Ref. |
| Plantae | Asteraceae | Tithonia tubaeformis | Ref. |
| Plantae | Asteraceae | Zexmenia brevifolia | Ref. |
|
|
zoom in
| Organism | Tithonia tagiliflora | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|