| Name |
Sirenin (-)-Sirenin Sirenin (Allomyces) l-Sirenin |
| Formula |
C15H24O2 |
| Mw |
236.17763001 |
| CAS RN |
19888-27-8 |
| C_ID |
C00003190
, 
|
| InChIKey |
BOEUJLMNWCJKHN-YARUXTLHNA-N |
| InChICode |
InChI=1S/C15H24O2/c1-11(9-16)4-3-7-15(2)13-6-5-12(10-17)8-14(13)15/h4,8,13-14,16-17H,3,5-7,9-10H2,1-2H3/b11-4+/t13-,14-,15+/m0/s1 |
| SMILES |
C/C(=CCC[C@@]1(C)[C@@H]2C=C(CO)CC[C@@H]21)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Saprolegniaceae | Saprolegnia ferax | Ref. |
| Fungi | Blastocladiaceae | Allomyces spp. | Ref. |
|
|
zoom in
| Organism | Saprolegnia ferax | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|