| Name |
Capsidiol |
| Formula |
C15H24O2 |
| Mw |
236.17763001 |
| CAS RN |
37208-05-2 |
| C_ID |
C00003108
, 
|
| InChIKey |
BXXSHQYDJWZXPB-QYDYKDTDNA-N |
| InChICode |
InChI=1S/C15H24O2/c1-9(2)11-5-6-12-14(17)7-13(16)10(3)15(12,4)8-11/h6,10-11,13-14,16-17H,1,5,7-8H2,2-4H3/t10-,11-,13-,14-,15-/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CC=C2[C@H](O)C[C@@H](O)[C@@H](C)[C@@]2(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Capsicum annuam | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Capsicum frutescens  | Ref. |
| Plantae | Solanaceae | Nicotiana attenuate | Ref. |
| Plantae | Solanaceae | Nicotiana sylvestris | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Nicotiana tomentosiformis | Ref. |
| - | - | Laurencia dendroidea | Ref. |
|
|
zoom in
| Organism | Capsicum annuam | | Reference | Kawaguchi, et al., Journal of Natural Products, 67, (2004), 1893.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|