| Name |
beta-Cadinene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
523-47-7 |
| C_ID |
C00003106
, 
|
| InChIKey |
USDOQCCMRDNVAH-JCUKGLBFNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5-6,10,13-15H,7-9H2,1-4H3/t13-,14-,15-/m0/s1 |
| SMILES |
CC1=CC[C@H]2C(C)=CC[C@@H](C(C)C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Pinaceae | Pinus caribaea  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Strobilanthes ixiocephala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|