| Name |
Monotropein |
| Formula |
C16H22O11 |
| Mw |
390.11621155 |
| CAS RN |
5945-50-6 |
| C_ID |
C00003089
, 
|
| InChIKey |
HPWWQPXTUDMRBI-LJIQLVJANA-N |
| InChICode |
InChI=1S/C16H22O11/c17-3-8-10(19)11(20)12(21)15(26-8)27-14-9-6(1-2-16(9,24)5-18)7(4-25-14)13(22)23/h1-2,4,6,8-12,14-15,17-21,24H,3,5H2,(H,22,23)/t6-,8+,9+,10+,11-,12+,14-,15-,16+/m0/s1 |
| SMILES |
O=C(O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@H]2[C@@H]1C=C[C@]2(O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
| Plantae | Ericaceae | Arctostaphylos uva-ursi | Ref. |
| Plantae | Ericaceae | Monotropa hypopithys | Ref. |
| Plantae | Ericaceae | Monotropa hypopitys | Ref. |
| Plantae | Ericaceae | Monotropa uniflora | Ref. |
| Plantae | Ericaceae | Pyrola elliptica | Ref. |
| Plantae | Ericaceae | Pyrola japonica | Ref. |
| Plantae | Ericaceae | Pyrola renifolia | Ref. |
| Plantae | Ericaceae | Pyrola spp. | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Globulariaceae | Globularia spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar orientalis | Ref. |
| Plantae | Hamamelidaceae | Liquidambar spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar styraciflua | Ref. |
| Plantae | Rubiaceae | Asperula spp. | Ref. |
| Plantae | Rubiaceae | Galium glaucum | Ref. |
| Plantae | Rubiaceae | Galium rivale | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia | Ref. |
| Plantae | Rubiaceae | Morinda officinalis | Ref. |
| Plantae | Rubiaceae | Saprosma scortechinii | Ref. |
|
|
zoom in
| Organism | Cornus suecica |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
