| Name |
4'-Prenyloxyresveratrol |
| Formula |
C19H20O4 |
| Mw |
312.13615913 |
| CAS RN |
69065-16-3 |
| C_ID |
C00002900
, 
|
| InChIKey |
FEHGVKWVMWWVQZ-SNAWJCMRSA-N |
| InChICode |
InChI=1S/C19H20O4/c1-12(2)3-8-16-18(22)9-13(10-19(16)23)4-5-14-6-7-15(20)11-17(14)21/h3-7,9-11,20-23H,8H2,1-2H3/b5-4+ |
| SMILES |
CC(C)=CCc1c(O)cc(/C=C/c2ccc(O)cc2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus integra  | Ref. |
| Plantae | Moraceae | Morus alba | Ref. |
|
|
zoom in
| Organism | Artocarpus integra |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Boonlaksiri, et al., Phytochemistry, 54, (2000), 415 |
|---|
|
