| Name |
Rapanone |
| Formula |
C19H30O4 |
| Mw |
322.21440945 |
| CAS RN |
573-40-0 |
| C_ID |
C00002860
, 
|
| InChIKey |
AMKNOBHCKRZHIO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
| SMILES |
CCCCCCCCCCCCCC1=C(O)C(=O)C=C(O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium indicum Ardisia crenata  | Ref. |
| Plantae | Connaraceae | Connarus monocarpus | Ref. |
| Plantae | Connaraceae | Rourea santaloides | Ref. |
| Plantae | Myrsinaceae | Aegiceras corniculatum | Ref. |
| Plantae | Myrsinaceae | Ardisia spp. | Ref. |
| Plantae | Myrsinaceae | Myrsine spp. | Ref. |
| Plantae | Myrsinaceae | Rapanea laetevirens | Ref. |
| Plantae | Myrsinaceae | Rapanea maximowiczii | Ref. |
| Plantae | Oxalidaceae | Oxalis purpurata | Ref. |
|
|
zoom in
| Organism | Heliotropium indicum Ardisia crenata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|