| Name |
Naphthazarin |
| Formula |
C10H6O4 |
| Mw |
190.02660868 |
| CAS RN |
475-38-7 |
| C_ID |
C00002846
, 
|
| InChIKey |
RQNVIKXOOKXAJQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H6O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-4,11-12H |
| SMILES |
O=C1C=CC(=O)c2c(O)ccc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica var. sieboldiana | Ref. |
| Plantae | Proteaceae | Lomatia obtigua | Ref. |
|
|
zoom in
| Organism | Arnebia euchroma | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Hu, et al., Planta Med, 70, (2004), 23 |
|---|
|