| Name |
1,3-Dihydroxy-2-methoxymethylanthraquinone Lucidin omega-methyl ether |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
79560-36-4 |
| C_ID |
C00002839
, 
|
| InChIKey |
OBAYLECORSQIQW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-21-7-11-12(17)6-10-13(16(11)20)15(19)9-5-3-2-4-8(9)14(10)18/h2-6,17,20H,7H2,1H3 |
| SMILES |
COCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda parvifolia  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
|
|
zoom in
| Organism | Morinda parvifolia | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|