| Name |
Chrysophanic acid 9-anthrone Chrysophanol anthrone |
| Formula |
C15H12O3 |
| Mw |
240.07864425 |
| CAS RN |
491-58-7 |
| C_ID |
C00002806
, 
|
| InChIKey |
ZZBWSNKBZKPGAK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H12O3/c1-8-5-10-7-9-3-2-4-11(16)13(9)15(18)14(10)12(17)6-8/h2-6,16-17H,7H2,1H3 |
| SMILES |
Cc1cc(O)c2c(c1)Cc1cccc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Fabaceae | Cassia siamea  | Ref. |
| Plantae | Fabaceae | Vatairea guianensis  | Ref. |
| Plantae | Polygonaceae | Rumex crispus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus purshiana  | Ref. |
| - | - | Ferreirea spectabilis | Ref. |
|
|
zoom in
| Organism | Aloe spp. | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|