| Name |
Gingerenone A |
| Formula |
C21H24O5 |
| Mw |
356.16237388 |
| CAS RN |
128700-97-0 |
| C_ID |
C00002747
, 
|
| InChIKey |
FWDXZNKYDTXGOT-GQCTYLIASA-N |
| InChICode |
InChI=1S/C21H24O5/c1-25-20-13-15(8-11-18(20)23)5-3-4-6-17(22)10-7-16-9-12-19(24)21(14-16)26-2/h4,6,8-9,11-14,23-24H,3,5,7,10H2,1-2H3/b6-4+ |
| SMILES |
COc1cc(CC/C=C/C(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber mioga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|