| Name |
Podorhizol beta-D-glucoside |
| Formula |
C28H34O13 |
| Mw |
578.19994117 |
| CAS RN |
17187-73-4 |
| C_ID |
C00002621
, 
|
| InChIKey |
IETDTZKBVWFSKR-FPQAMKHFNA-N |
| InChICode |
InChI=1S/C28H34O13/c1-34-18-8-14(9-19(35-2)26(18)36-3)25(41-28-24(32)23(31)22(30)20(10-29)40-28)21-15(11-37-27(21)33)6-13-4-5-16-17(7-13)39-12-38-16/h4-5,7-9,15,20-25,28-32H,6,10-12H2,1-3H3/t15-,20+,21-,22+,23-,24-,25+,28-/m0/s1 |
| SMILES |
COc1cc([C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@H]2C(=O)OC[C@@H]2Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum emodii | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
|
|
zoom in
| Organism | Podophyllum emodii | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|