| Name |
Paniculatin |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
32361-88-9 |
| C_ID |
C00002557
, 
|
| InChIKey |
ISNRVVKKHPECQN-NBNQLFPDNA-N |
| InChICode |
InChI=1S/C27H30O15/c28-5-11-17(32)21(36)23(38)26(41-11)14-19(34)13-16(31)10(8-1-3-9(30)4-2-8)7-40-25(13)15(20(14)35)27-24(39)22(37)18(33)12(6-29)42-27/h1-4,7,11-12,17-18,21-24,26-30,32-39H,5-6H2/t11-,12-,17-,18-,21+,22+,23-,24-,26+,27+/m1/s1 |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3OC(CO)[C@@H](O)C(O)[C@H]3O)c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia nitidula  | Ref. |
| Plantae | Fabaceae | Dalbergia paniculata  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Dalbergia nitidula | | Reference | Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter38
Harborne,The Handbook of Natural Flavonoids,1,(1999),549,C-glycosylflavones
Narayanan,Indian J.Chem.,9,(1971),14
van Heerden,J.Chem.Soc.,Perkin Trans.,1,(1980),2463 |
|---|
|