| Name |
5,6,7-Trimethoxycoumarin |
| Formula |
C12H12O5 |
| Mw |
236.06847349 |
| CAS RN |
55085-47-7 |
| C_ID |
C00002501
, 
|
| InChIKey |
FOBNRKTURPWTQX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H12O5/c1-14-9-6-8-7(4-5-10(13)17-8)11(15-2)12(9)16-3/h4-6H,1-3H3 |
| SMILES |
COc1cc2oc(=O)ccc2c(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron collettianum | Ref. |
| Plantae | Euphorbiaceae | Aleurites cordata | Ref. |
| Plantae | Euphorbiaceae | Aleurites fordii | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Rutaceae | Diosma pilosa | Ref. |
|
|
zoom in
| Organism | Rhododendron collettianum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Ahmad, et al., Chem Pharm Bull, 52, (2004), 1458 |
|---|
|