| Name |
Mulberrofuran C |
| Formula |
C34H28O9 |
| Mw |
580.17333249 |
| CAS RN |
77996-04-4 |
| C_ID |
C00002405
, 
|
| InChIKey |
WTGKDESIYCVAOP-UBIMOTNUNA-N |
| InChICode |
InChI=1S/C34H28O9/c1-16-8-24(22-6-4-19(35)13-26(22)38)32(34(42)23-7-5-20(36)14-27(23)39)25(9-16)33-28(40)10-18(11-29(33)41)30-12-17-2-3-21(37)15-31(17)43-30/h2-7,9-15,24-25,32,35-41H,8H2,1H3/t24-,25-,32-/m0/s1 |
| SMILES |
CC1=C[C@@H](c2c(O)cc(-c3cc4ccc(O)cc4o3)cc2O)[C@@H](C(=O)c2ccc(O)cc2O)[C@H](c2ccc(O)cc2O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus bombycis  | Ref. |
| Plantae | Moraceae | Morus lhou | Ref. |
|
|
zoom in
| Organism | Morus alba | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Nomura,Planta Med.,46,(1982),28
Hano,Heterocycles,27,(1988),2315 |
|---|
|