| Name |
Paravallarine |
| Formula |
C22H33NO2 |
| Mw |
343.2511293 |
| CAS RN |
510-31-6 |
| C_ID |
C00002255
, 
|
| InChIKey |
RSFPISDAJMWREU-IPUJKDGRNA-N |
| InChICode |
InChI=1S/C22H33NO2/c1-13-17-6-7-19-16-5-4-14-12-15(23-3)8-10-21(14,2)18(16)9-11-22(17,19)20(24)25-13/h4,13,15-19,23H,5-12H2,1-3H3/t13-,15-,16+,17+,18-,19-,21-,22-/m0/s1 |
| SMILES |
CN[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5[C@H](C)OC(=O)[C@@]54CC[C@@H]32)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Holarrhena antidysenterica  | Ref. |
| Plantae | Apocynaceae | Paravallaris microphylla | Ref. |
|
|
zoom in
| Organism | Holarrhena antidysenterica | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|