| Name |
Lycofawcine |
| Formula |
C18H29NO4 |
| Mw |
323.20965842 |
| CAS RN |
3175-90-4 |
| C_ID |
C00001945
, 
|
| InChIKey |
ZHMNKOPAHVBXQW-SYSZZGASNA-N |
| InChICode |
InChI=1S/C18H29NO4/c1-11-10-17-13-5-3-7-19(17)8-4-6-18(17,22)14(16(11)21)9-15(13)23-12(2)20/h11,13-16,21-22H,3-10H2,1-2H3/t11-,13+,14+,15+,16+,17-,18-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@@H]2[C@H](O)[C@@H](C)C[C@@]34[C@@H]1CCCN3CCC[C@]24O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium annotinum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium fawcettii | Ref. |
|
|
zoom in
| Organism | Lycopodium annotinum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|