| Name |
Lophophorine |
| Formula |
C13H17NO3 |
| Mw |
235.12084342 |
| CAS RN |
17627-78-0 |
| C_ID |
C00001881
, 
|
| InChIKey |
PNFBXEKHLUDPIM-SVGMAFHSNA-N |
| InChICode |
InChI=1S/C13H17NO3/c1-8-11-9(4-5-14(8)2)6-10(15-3)12-13(11)17-7-16-12/h6,8H,4-5,7H2,1-3H3/t8-/m0/s1 |
| SMILES |
COc1cc2c(c3c1OCO3)[C@H](C)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cactaceae | Lophophora willamsii | Ref. |
| Plantae | Cactaceae | Lophophora williamsii | Ref. |
|
|
zoom in
| Organism | Lophophora willamsii | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|