| Name |
Emetine |
| Formula |
C29H40N2O4 |
| Mw |
480.29880778 |
| CAS RN |
483-18-1 |
| C_ID |
C00001849
, 
|
| InChIKey |
AUVVAXYIELKVAI-PCBPFIOTNA-N |
| InChICode |
InChI=1S/C29H40N2O4/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3/t18-,21-,24+,25-/m0/s1 |
| SMILES |
CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1C[C@H]1NCCc2cc(OC)c(OC)cc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Hedera helix  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium longiflorum | Ref. |
| Plantae | Rubiaceae | Cephaelis acuminata | Ref. |
| Plantae | Rubiaceae | Cephaelis ipecacuanha | Ref. |
| Plantae | Rubiaceae | Psychotria burucana | Ref. |
| Plantae | Rubiaceae | Psychotria ipecacuanha | Ref. |
| Plantae | Rubiaceae | Psychotria klugii | Ref. |
| - | - | Carapichea affinis | Ref. |
| - | - | Cephalis acuminata | Ref. |
| - | - | Cephalis ipecacuanha | Ref. |
| - | - | Uragoga ipecacuanha | Ref. |
|
|
zoom in
| Organism | Hedera helix |
|---|
| Reference | Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986). |
|---|
|
