| Name |
Mitraphylline |
| Formula |
C21H24N2O4 |
| Mw |
368.17360727 |
| CAS RN |
509-80-8 |
| C_ID |
C00001752
, 
|
| InChIKey |
JMIAZDVHNCCPDM-KRPCLKTGNA-N |
| InChICode |
InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14+,18-,21+/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](C)[C@H]2CN3CC[C@]4(C(=O)Nc5ccccc54)[C@@H]3C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Rubiaceae | Mitragyna hirsuta | Ref. |
| Plantae | Rubiaceae | Mitragyna macrophylla | Ref. |
| Plantae | Rubiaceae | Mitragyna parvifolia  | Ref. |
| Plantae | Rubiaceae | Mitragyna rubrostipula | Ref. |
| Plantae | Rubiaceae | Uncaria africana  | Ref. |
| Plantae | Rubiaceae | Uncaria attenuata | Ref. |
| Plantae | Rubiaceae | Uncaria callophylla | Ref. |
| Plantae | Rubiaceae | Uncaria elliptica | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Rubiaceae | Uncaria guianensis  | Ref. |
| Plantae | Rubiaceae | Uncaria hirsuta  | Ref. |
| Plantae | Rubiaceae | Uncaria homomalla | Ref. |
| Plantae | Rubiaceae | Uncaria kawakamii | Ref. |
| Plantae | Rubiaceae | Uncaria laevigata | Ref. |
| Plantae | Rubiaceae | Uncaria lancifolia | Ref. |
| Plantae | Rubiaceae | Uncaria lanosa | Ref. |
| Plantae | Rubiaceae | Uncaria longiflora | Ref. |
| Plantae | Rubiaceae | Uncaria orientalis | Ref. |
| Plantae | Rubiaceae | Uncaria scandens  | Ref. |
| Plantae | Rubiaceae | Uncaria sessilifructus  | Ref. |
| Plantae | Rubiaceae | Uncaria tomentosa  | Ref. |
| Plantae | Rubiaceae | Uncaria veluntina | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|