| Name |
Mesembrinol |
| Formula |
C17H25NO3 |
| Mw |
291.18344367 |
| CAS RN |
23544-42-5 |
| C_ID |
C00001750
, 
|
| InChIKey |
KPMLOZVRLWHOBN-XZWXJQEONA-N |
| InChICode |
InChI=1S/C17H25NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,13,16,19H,6-9,11H2,1-3H3/t13-,16+,17+/m1/s1 |
| SMILES |
COc1ccc([C@@]23CC[C@@H](O)C[C@@H]2N(C)CC3)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Mesembryanthemum anatomicum  | Ref. |
| Plantae | Aizoaceae | Mesembryanthemum expansum | Ref. |
| Plantae | Aizoaceae | Mesembryanthemum tortuosum | Ref. |
| Plantae | Aizoaceae | Sceletium anatomicum | Ref. |
| Plantae | Aizoaceae | Sceletium expansum | Ref. |
| Plantae | Aizoaceae | Sceletium tortuosum | Ref. |
|
|
zoom in
| Organism | Mesembryanthemum anatomicum |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
