| Name |
Ibogamine |
| Formula |
C19H24N2 |
| Mw |
280.19394878 |
| CAS RN |
481-87-8 |
| C_ID |
C00001742
, 
|
| InChIKey |
LRLCVRYKAFDXKU-HGCPLKDXNA-N |
| InChICode |
InChI=1S/C19H24N2/c1-2-13-9-12-10-16-18-15(7-8-21(11-12)19(13)16)14-5-3-4-6-17(14)20-18/h3-6,12-13,16,19-20H,2,7-11H2,1H3/t12-,13+,16+,19+/m1/s1 |
| SMILES |
CC[C@H]1C[C@@H]2C[C@H]3c4[nH]c5ccccc5c4CC[N@@](C2)[C@@H]13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Ervatamia divaricata Gouyahua | Ref. |
| Plantae | Apocynaceae | Tabernaemontana calcarea | Ref. |
| Plantae | Apocynaceae | Tabernaemontana markgrafiana | Ref. |
| Plantae | Apocynaceae | Tabernanthe iboga  | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|