| Name |
Lycorenine |
| Formula |
C18H23NO4 |
| Mw |
317.16270823 |
| CAS RN |
477-19-0 |
| C_ID |
C00001574
, 
|
| InChIKey |
VHYYSQODIQWPDO-PSOQJSIDNA-N |
| InChICode |
InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3/t13-,16-,17-,18+/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@@H](O)O[C@@H]1CC=C3CCN(C)[C@H]3[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Leucojum aestivum  | Ref. |
| Plantae | Amaryllidaceae | Lycoris aurea  | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata  | Ref. |
| Plantae | Amaryllidaceae | Narcissus bujei | Ref. |
| Plantae | Amaryllidaceae | Narcissus poeticus | Ref. |
| Plantae | Amaryllidaceae | Narcissus tazetta L.  | Ref. |
|
|
zoom in
| Organism | Leucojum aestivum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|