| Name |
Isatan B
Isotan B |
| Formula |
C14H15NO6 |
| Mw |
293.08993722 |
| CAS RN |
20307-14-6 |
| C_ID |
C00001542
, 
|
| InChIKey |
KGXOHVOUKNLUNP-WMLRJBABNA-N |
| InChICode |
InChI=1S/C14H15NO7/c16-6-14(20)12(18)10(17)11(22-14)13(19)21-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-12,15-18,20H,6H2/t10-,11-,12-,14+/m0/s1 |
| SMILES |
O=C(Oc1c[nH]c2ccccc12)[C@H]1O[C@](O)(CO)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria | Ref. |
|
|
zoom in
| Organism | Isatis indigotica |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
