| Name |
Volkenin (1R,4R)-Volkenin |
| Formula |
C12H17NO7 |
| Mw |
287.10050191 |
| CAS RN |
66575-40-4 |
| C_ID |
C00001459
, 
|
| InChIKey |
JRCWYCAEAZEYNW-PFULJPMJNA-N |
| InChICode |
InChI=1S/C12H17NO7/c13-5-12(2-1-6(15)3-12)20-11-10(18)9(17)8(16)7(4-14)19-11/h1-2,6-11,14-18H,3-4H2/t6-,7+,8-,9-,10+,11-,12-/m0/s1 |
| SMILES |
N#C[C@]1(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)C=C[C@H](O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Passifloraceae | Barteria fistulosa | Ref. |
| Plantae | Passifloraceae | Passiflora coriacea Juss.  | Ref. |
| Plantae | Passifloraceae | Passiflora discophora Jorg & Law. | Ref. |
| Plantae | Passifloraceae | Passiflora foetida L.  | Ref. |
| Plantae | Passifloraceae | Passiflora tetrandra Banks & Sol.ex.DC. | Ref. |
| - | - | Bartera fistulosa | Ref. |
|
|
zoom in
| Organism | Barteria fistulosa | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|