| Name |
Safynol |
| Formula |
C13H12O2 |
| Mw |
200.08372963 |
| CAS RN |
27978-14-9 |
| C_ID |
C00001292
, 
|
| InChIKey |
GVCJUCQUVWZELI-XNBFGFCUNA-N |
| InChICode |
InChI=1S/C13H12O2/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h2-3,10-11,13-15H,12H2,1H3/b3-2+,11-10+/t13-/m0/s1 |
| SMILES |
C/C=C/C#CC#CC#C/C=C/[C@H](O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Bidens bipinnata  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea spp. | Ref. |
| - | - | Carthamnus tinctorius | Ref. |
|
|
zoom in
| Organism | Bidens bipinnata | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Wang, et al., CTHD, 36, (2005), 20 |
|---|
|