| Name |
Planteose |
| Formula |
C18H32O16 |
| Mw |
504.16903498 |
| CAS RN |
470-57-5 |
| C_ID |
C00001144
, 
|
| InChIKey |
NIBVDXPSJBYJFT-XHDZRHAANA-N |
| InChICode |
InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-10(24)15(29)18(4-21,33-7)34-17-14(28)12(26)9(23)6(2-20)32-17/h5-17,19-29H,1-4H2/t5-,6+,7+,8-,9+,10-,11-,12-,13-,14+,15+,16-,17+,18-/m0/s1 |
| SMILES |
OCC1O[C@H](O[C@]2(CO)O[C@H](CO[C@H]3OC(CO)[C@H](O)[C@H](O)C3O)[C@H](O)C2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Teucrium spp. | Ref. |
| Plantae | Oleaceae | Fraxinus spp. | Ref. |
| Plantae | Plantaginaceae | Plantago spp. | Ref. |
|
|
zoom in
| Organism | Ocimum basilicum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|