| Name |
beta-D-glucuronic acid D-Glucuronic acid |
| Formula |
C6H10O7 |
| Mw |
194.04265268 |
| CAS RN |
6556-12-3 |
| C_ID |
C00001123
, 
|
| InChIKey |
AEMOLEFTQBMNLQ-NRYQRBSKNA-N |
| InChICode |
InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes bidentata  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Ericaceae | Gaultheria miqueliana | Ref. |
|
|
zoom in
| Organism | Achyranthes bidentata | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|