| Name |
Galangin 3,5,7-trimethyl ether Galangin trimethyl ether 3,5,7-trimethoxyflavone |
| Formula |
C18H16O5 |
| Mw |
312.09977362 |
| CAS RN |
26964-29-4 |
| C_ID |
C00001042
, 
|
| InChIKey |
CBTHKWVPSIGKMI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| SMILES |
COc1cc(OC)c2c(=O)c(OC)c(-c3ccccc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Gomphrena martiana | Ref. |
| Plantae | Asteraceae | Helichrysum nitens | Ref. |
| Plantae | Lauraceae | Aniba riparia | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Gomphrena martiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Franca,Phytochem.,15,(1976),572 |
|---|
|