| Name |
Caffeoyl tyramine N-trans-caffeoyltyramine |
| Formula |
C17H17NO4 |
| Mw |
299.11575804 |
| CAS RN |
103188-48-3 |
| C_ID |
C00000662
, 
|
| InChIKey |
VSHUQLRHTJOKTA-XBXARRHUSA-N |
| InChICode |
InChI=1S/C17H17NO4/c19-14-5-1-12(2-6-14)9-10-18-17(22)8-4-13-3-7-15(20)16(21)11-13/h1-8,11,19-21H,9-10H2,(H,18,22)/b8-4+ |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)NCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Tinospora crispa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|