| Name |
epi-Methyl jasmonate Methyl epijasmonate Methyl-7-iso-jasmonate |
| Formula |
C13H20O3 |
| Mw |
224.1412445 |
| CAS RN |
42536-97-0 |
| C_ID |
C00000223
, 
|
| InChIKey |
GEWDNTWNSAZUDX-ZFTSMRCKNA-N |
| InChICode |
InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4-/t10-,11+/m0/s1 |
| SMILES |
CC/C=CC[C@H]1C(=O)CC[C@H]1CC(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|