| Name |
Lunularic acid |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
23255-59-6 |
| C_ID |
C00000212
, 
|
| InChIKey |
GFSQDOUEUWXRSL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O4/c16-12-8-5-10(6-9-12)4-7-11-2-1-3-13(17)14(11)15(18)19/h1-3,5-6,8-9,16-17H,4,7H2,(H,18,19) |
| SMILES |
O=C(O)c1c(O)cccc1CCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Calypogeia | Calypogeia tosana | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla  | Ref. |
| Plantae | Jubulaceae | Frullania convoluta | Ref. |
| Plantae | Marchantiaceae | Marchantia polymorpha | Ref. |
| Plantae | Ophioglossaceae | Lunularia cruciata | Ref. |
| Plantae | Ophioglossaceae | Lunularia spp. | Ref. |
| Plantae | Ricciaceae | Ricciocarpos natans | Ref. |
| - | - | Blasia pusilla | Ref. |
| - | - | Corsinia coriandrina | Ref. |
| - | - | Lophocolea heterophylla | Ref. |
|
|
zoom in
| Organism | Allium spp. | | Reference | Goda,105th Annual Meeting of the Pharmacological Society of Japan,(1985),468 |
|---|
|