Name |
(-)-Alpinetin Alpinetin |
Formula |
C16H14O4 |
Mw |
270.08920894 |
CAS RN |
36052-37-6 |
C_ID |
C00008143
,
|
InChIKey |
QQQCWVDPMPFUGF-UHFFFAOYNA-N |
InChICode |
InChI=1S/C16H14O4/c1-19-14-7-11(17)8-15-16(14)12(18)9-13(20-15)10-5-3-2-4-6-10/h2-8,13,17H,9H2,1H3/t13-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccccc1)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Helichrysum forskahlii | Ref. |
Plantae | Asteraceae | Helichrysum spp. | Ref. |
Plantae | Asteraceae | Mikania micrantha | Ref. |
Plantae | Betulaceae | Alnus spp. | Ref. |
Plantae | Combretaceae | Combretum albopunctatum Suesseng | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Dalea scandens | Ref. |
Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
Plantae | Labiatae | Scutellaria spp. | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Piperaceae | Piper spp. | Ref. |
Plantae | Zingiberaceae | Alpinia mutica | Ref. |
Plantae | Zingiberaceae | Alpinia pinnanensis | Ref. |
Plantae | Zingiberaceae | Alpinia spp. | Ref. |
Plantae | Zingiberaceae | Boesenbergia pandurata | Ref. |
Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF. | Ref. |
Plantae | Zingiberaceae | Kaempferia spp. | Ref. |
|
|
zoom in
Organism | Alnus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 237,Flavanones and dihydroflavonols
Hansel,Planta Med.,15,(1967),443
Kimura,Yakugaku Zasshi,88,(1968),239 |
---|
|