Name |
Cyanidin 3-sophoroside Cyanidin-3-sophoroside |
Formula |
C27H31O16 |
Mw |
611.16120995 |
CAS RN |
38820-68-7,18376-31-3 |
C_ID |
C00006658
,
|
InChIKey |
SXYMMDGPXYVCER-XWOBYZRTNA-O |
InChICode |
InChI=1S/C27H30O16/c28-7-17-19(34)21(36)23(38)26(41-17)43-25-22(37)20(35)18(8-29)42-27(25)40-16-6-11-13(32)4-10(30)5-15(11)39-24(16)9-1-2-12(31)14(33)3-9/h1-6,17-23,25-29,34-38H,7-8H2,(H3-,30,31,32,33)/p+1/t17-,18+,19-,20-,21+,22+,23-,25-,26+,27-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Stapelia spp. | Ref. |
Plantae | Aquifoliaceae | Ilex pubescens | Ref. |
Plantae | Asteraceae | Cynara scolymus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
Plantae | Convolvulaceae | Ipomoea purpurea | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus spp. | Ref. |
Plantae | Crassulaceae | Cotyledon spp. | Ref. |
Plantae | Crassulaceae | Crassula spp. | Ref. |
Plantae | Crassulaceae | Tylecodon spp. | Ref. |
Plantae | Fabaceae | Amphithalea spp. | Ref. |
Plantae | Fabaceae | Coelidium spp. | Ref. |
Plantae | Fabaceae | Erythrina spp. | Ref. |
Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
Plantae | Fabaceae | Liparia spp. | Ref. |
Plantae | Grossulariaceae | Ribes spp. | Ref. |
Plantae | Malvaceae | Abelmoschus spp. | Ref. |
Plantae | Malvaceae | Thespesia spp. | Ref. |
Plantae | Papaveraceae | Papaver bracteatum | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Rosaceae | Rubus idaeus | Ref. |
Plantae | Solanaceae | Nicotiana setchellii | Ref. |
|
|
zoom in
Organism | Abelmoschus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
---|
|