Name |
Schaftoside Shaftoside |
Formula |
C26H28O14 |
Mw |
564.14790561 |
CAS RN |
51938-32-0 |
C_ID |
C00006177
,
|
InChIKey |
MMDUKUSNQNWVET-WCGZTJJSNA-N |
InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17-,18-,21+,22+,23-,25-,26+/m1/s1 |
SMILES |
c1(c(c(c2c(c1[C@@H]1[C@H]([C@@H]([C@@H](CO1)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Apiaceae | Astrantia major | Ref. |
Plantae | Araceae | Arisaema consanguineum | Ref. |
Plantae | Araceae | Arisaema heterophyllum | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asteraceae | Catananche caerulea | Ref. |
Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Asteraceae | Centaurea solstitialis | Ref. |
Plantae | Caryophyllaceae | Silene schafta | Ref. |
Plantae | Caryophyllaceae | Stellaria holostea | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Caryophyllaceae | Stellaria nemorum | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Labiatae | Meehania urticifolia | Ref. |
Plantae | Labiatae | Salvia blepharophylla | Ref. |
Plantae | Metzgeriaceae | Metzgeria furcata | Ref. |
Plantae | Poaceae | Dactylis glomerata | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Rosaceae | Crataegus monogyna L. | Ref. |
Plantae | Rosaceae | Cydonia oblonga | Ref. |
Plantae | Solanaceae | Capsicum annum L. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
Organism | Glycyrrhiza uralensis | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|