Name |
Guaijaverin Quercetin 3-O-alpha-L-arabinopyranoside |
Formula |
C20H18O11 |
Mw |
434.08491142 |
CAS RN |
22255-13-6 |
C_ID |
C00005368
,
|
InChIKey |
PZZRDJXEMZMZFD-ZHWQENFZNA-N |
InChICode |
InChI=1S/C20H18O11/c21-8-4-11(24)14-13(5-8)30-18(7-1-2-9(22)10(23)3-7)19(16(14)27)31-20-17(28)15(26)12(25)6-29-20/h1-5,12,15,17,20-26,28H,6H2/t12-,15-,17-,20+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H](CO1)O)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Ericaceae | Arctostaphylos uva-ursi | Ref. |
Plantae | Ericaceae | Calluna vulgaris | Ref. |
Plantae | Ericaceae | Chamaedaphne calyculata | Ref. |
Plantae | Ericaceae | Richea angustifolia | Ref. |
Plantae | Ericaceae | Richea scoparia | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus | Ref. |
Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
Plantae | Lauraceae | Machilus thunbergii | Ref. |
Plantae | Malvaceae | Hibiscus mutabilis | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Myrtaceae | Eucalyptus cypellocarpa | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Polygalaceae | Securidaca diversifolia | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Taxodiaceae | Taxodium distichum | Ref. |
|
|
zoom in
Organism | Richea angustifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Khadem,J.Chem.Soc.,(1958),3320 |
---|
|