Name |
Rhamnetin 3,5,3',4'-Tetrahydroxy-7-methoxyflavone 7-Methoxyquercetin 2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1- benzopyran-4-one 7-O-Methxyl quercetin Rhamnose |
Formula |
C16H12O7 |
Mw |
316.05830274 |
CAS RN |
90-19-7 |
C_ID |
C00004634
,
|
InChIKey |
JGUZGNYPMHHYRK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia campestris ssp. glutinosa | Ref. |
Plantae | Asteraceae | Artemisia glutinosa | Ref. |
Plantae | Asteraceae | Baccharis pilularis | Ref. |
Plantae | Asteraceae | Blumea balsamifera | Ref. |
Plantae | Asteraceae | Cassinia vauvilliersii | Ref. |
Plantae | Asteraceae | Centaurea collina L. | Ref. |
Plantae | Asteraceae | Chromolaena meridensis | Ref. |
Plantae | Asteraceae | Chromolaena odorata | Ref. |
Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
Plantae | Asteraceae | Flourensia thurifera | Ref. |
Plantae | Asteraceae | Madia elegans | Ref. |
Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Pulicaria dysenterica | Ref. |
Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
Plantae | Capparaceae | Capparis tweediana | Ref. |
Plantae | Crassulaceae | Aeonium spp. | Ref. |
Plantae | Cruciferae | Erysimum carniolicum | Ref. |
Plantae | Dilleniaceae | Dillenia spp. | Ref. |
Plantae | Dilleniaceae | Tetracera asiatica | Ref. |
Plantae | Dilleniaceae | Tetracera spp. | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Acacia ixiophylla | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Labiatae | Meehania urticifolia | Ref. |
Plantae | Labiatae | Pogostemon cablin | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa pterygosperma | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus obliqua | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Polygonaceae | Polygonum amphibium | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
Plantae | Polygonaceae | Polygonum mite | Ref. |
Plantae | Polygonaceae | Polygonum persicaria | Ref. |
Plantae | Rhamnaceae | Rhamnus alaternus | Ref. |
Plantae | Rhamnaceae | Rhamnus cathartica | Ref. |
Plantae | Rhamnaceae | Rhamnus catharticus | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rhamnaceae | Rhamnus saxatilis | Ref. |
Plantae | Salicaceae | Populus nigra | Ref. |
Plantae | Santalaceae | Viscum album | Ref. |
Plantae | Santalaceae | Viscum cruciatum | Ref. |
Plantae | Smilacaceae | Smilax riparia | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
|
|
zoom in
Organism | Pogostemon cablin | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chi, et al., ZYZ, 31, (1996), 264.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|