Name |
Chrysin 5,7-Dihydroxyflavone 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
Formula |
C15H10O4 |
Mw |
254.05790881 |
CAS RN |
480-40-0 |
C_ID |
C00003794
,
|
InChIKey |
RTIXKCRFFJGDFG-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccccc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
Plantae | Annonaceae | Anomianthus dulcis | Ref. |
Plantae | Asteraceae | Artemisia campestris ssp. glutinosa | Ref. |
Plantae | Asteraceae | Baccharis viminea | Ref. |
Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
Plantae | Asteraceae | Flourensia resinosa | Ref. |
Plantae | Asteraceae | Mikania hirsutissima | Ref. |
Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Chenopodiaceae | Chenopodium graveolens | Ref. |
Plantae | Cistaceae | Cistus populifolius | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Escalloniaceae | Escallonia spp. | Ref. |
Plantae | Fabaceae | Acacia constricta | Ref. |
Plantae | Fabaceae | Acacia neovernicosa | Ref. |
Plantae | Fabaceae | Ononis vaginalis | Ref. |
Plantae | Fabaceae | Oxytropis pseudoglandulosa | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Scutellaria amoena | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria discolor | Ref. |
Plantae | Labiatae | Scutellaria oreophila | Ref. |
Plantae | Labiatae | Scutellaria orientalis | Ref. |
Plantae | Labiatae | Scutellaria strigillosa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Orchidaceae | Cypripedium macranthos var. rebunense | Ref. |
Plantae | Passifloraceae | Passiflora caerulea | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Phrymaceae | Mimulus moschatus | Ref. |
Plantae | Pinaceae | Pinus aristata | Ref. |
Plantae | Pinaceae | Pinus excelsa | Ref. |
Plantae | Pinaceae | Pinus monticola | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Primulaceae | Primula farinose | Ref. |
Plantae | Pteridaceae | Cheilanthes kaulfussii | Ref. |
Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rubiaceae | Adina cordifolia Roxb. | Ref. |
Plantae | Salicaceae | Populus alba | Ref. |
Plantae | Salicaceae | Populus alba var.pyramdalis | Ref. |
Plantae | Salicaceae | Populus bejingensis | Ref. |
Plantae | Salicaceae | Populus canadensis | Ref. |
Plantae | Salicaceae | Populus davidiana | Ref. |
Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Salicaceae | Populus tomentosa | Ref. |
Plantae | Salicaceae | Populus xiaohei | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Ulmaceae | Ulmus sieboldiana | Ref. |
Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
|
|
zoom in
Organism | Origanum vulgare | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|