Name |
Vanillin |
Formula |
C8H8O3 |
Mw |
152.04734412 |
CAS RN |
5463-22-9 |
C_ID |
C00002683
,
|
InChIKey |
MWOOGOJBHIARFG-UHFFFAOYSA-N |
InChICode |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
SMILES |
c1(c(cc(cc1)C=O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Rhus semialata | Ref. |
Plantae | Annonaceae | Annona purpurea | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
Plantae | Apiaceae | Ferula assa-foetida | Ref. |
Plantae | Apiaceae | Ligusticum chuanxiung | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl | Ref. |
Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
Plantae | Asparagaceae | Asparagus cochinchinensis | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asparagaceae | Asparagus spp. | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Dahlia spp. | Ref. |
Plantae | Asteraceae | Gynura elliptica | Ref. |
Plantae | Asteraceae | Gynura segetum | Ref. |
Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
Plantae | Asteraceae | Ligularia stenocephala Matsum.et Koidz. | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caryophyllales | Beta spp. | Ref. |
Plantae | Celastraceae | Microtropis japonica | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Equisetaceae | Equisetum hiemale | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Gesneriaceae | Aeschynanthus bracteatus | Ref. |
Plantae | Hamamelidaceae | Liquidambar orientalis | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Hypoxidaceae | Curculigo capitulata | Ref. |
Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Lauraceae | Beilschmiedia erythrophloia | Ref. |
Plantae | Lauraceae | Cassytha filiformis | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Lauraceae | Phoebe formosana | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
Plantae | Orchidaceae | Gastrodia elata | Ref. |
Plantae | Orchidaceae | Gymnadenia spp. | Ref. |
Plantae | Orchidaceae | Vanilla planifolia | Ref. |
Plantae | Orchidaceae | Vanilla spp. | Ref. |
Plantae | Phyllanthaceae | Phyllanthus oligospermus | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Spiraea spp. | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus limonia | Ref. |
Plantae | Rutaceae | Ruta spp. | Ref. |
Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
Plantae | Santalaceae | Viscum articulactum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Styracaceae | Styrax benzoin | Ref. |
Plantae | Taxaceae | Taxus mairei | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Urticaceae | Urtica dioica | Ref. |
Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | Caffea sp. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Ulva pertusa | Ref. |
|
|
zoom in
Organism | Ligusticum chuanxiung | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Chen, et al., APS, 30, (1995), 526.
Han, et al., APS, 26, (1991), 426.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
Pan, et al., JNP, 66, (2003), 161.
Banskota, et al., Planta Med, 69, (2003), 500.
Lin, et al., Planta Med, 69, (2003), 757.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
---|
|