Name |
Syringic acid Syringate 4-Hydroxy-3,5-dimethoxybenzoic acid |
Formula |
C9H10O5 |
Mw |
198.05282343 |
CAS RN |
530-57-4 |
C_ID |
C00002674
,
|
InChIKey |
JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
SMILES |
c1(cc(cc(c1O)OC)C(=O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Fungi | Hymenochaetaceae | Inonotus obliquus | Ref. |
Fungi | Hymenochaetaceae | Phellinus igniarius | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Calendula officinalis | Ref. |
Plantae | Asteraceae | Chamomilla rectita | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Conyza canadensis | Ref. |
Plantae | Asteraceae | Conyza candensis | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Balsaminaceae | Impatiens balsamina | Ref. |
Plantae | Bignoniaceae | Catalpa ovata | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Microtropis fokienensis | Ref. |
Plantae | Clusiaceae-Guttiferae | Caraipa densifolia | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Crassulaceae | Bryophyllum pinnatum | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ericaceae | Rhododendron dauricum | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron mucronulatum | Ref. |
Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr. | Ref. |
Plantae | Fabaceae | Derris scandens | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fagaceae | Quercus infectoria | Ref. |
Plantae | Hypoxidaceae | Curculigo orchioides | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Callicarpa integerrima | Ref. |
Plantae | Labiatae | Hyssopus officinalis | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja hortensis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Althaea nudiflora | Ref. |
Plantae | Malvaceae | Althaea officinalis | Ref. |
Plantae | Malvaceae | Althaea rosea | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Malvaceae | Hibiscus tiliaceus | Ref. |
Plantae | Meliaceae | Trichilia emetica | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Phoenix dactylifera | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
Plantae | Poaceae | Avena sativa | Ref. |
Plantae | Poaceae | Eleusine coracana | Ref. |
Plantae | Poaceae | Hordeum vulgare | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Panicum milliaceum | Ref. |
Plantae | Poaceae | Secale cereale | Ref. |
Plantae | Poaceae | Sorghum bicolor | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rhamnaceae | Ceanothus americanus | Ref. |
Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
Plantae | Rosaceae | Mespilus germanica | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
Plantae | Smilacaceae | Smilax glabra | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Tamaricaceae | Tamarix gallica | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
- | - | Anisophyllea dichostyla | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Lentinula edodes | Ref. |
- | - | Scrophularis sambucifolia | Ref. |
- | - | Stenoloma chusanum | Ref. |
|
|
zoom in
Organism | Foeniculum vulgare | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Yi, et al., APS, 30, (1995), 718.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
TAO, et al., Chem Pharm Bull, 51, (2003), 654.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
WU, et al., Chem Pharm Bull, 53, (2005), 1065.
Pan, et al., JNP, 66, (2003), 161.
Morikawa, et al., JNP, 66, (2003), 638.
Mo, et al., JNP, 67, (2004), 823.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|