Name |
(+)-Ascorbic acid L-Ascorbic acid L-Ascorbate Vitamin C |
Formula |
C6H8O6 |
Mw |
176.03208799 |
CAS RN |
50-81-7 |
C_ID |
C00001179
,
|
InChIKey |
CIWBSHSKHKDKBQ-DOMZIZNONA-N |
InChICode |
InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
SMILES |
C1(=C(C(=O)O[C@@H]1[C@@H](O)CO)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Piperaceae | Peperomia sui | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Rubus idaeus L. | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Colocasia escultenta | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|