Name |
Narirutin |
Formula |
C27H32O14 |
Mw |
580.17920573 |
CAS RN |
14259-46-2 |
C_ID |
C00000984
,
|
InChIKey |
HXTFHSYLYXVTHC-RGNCLQGVNA-N |
InChICode |
InChI=1S/C27H32O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-7,10,16,18,20-29,31-36H,8-9H2,1H3/t10-,16+,18-,20+,21-,22-,23+,24+,25-,26-,27-/m1/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@@H]1O[C@@H]([C@@H]([C@H]([C@@H]1O)O)O)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Asteraceae | Cynara scolymus | Ref. |
Plantae | Lamiaceae | Acinos suaveolens | Ref. |
Plantae | Rubiaceae | Hamelia patens | Ref. |
Plantae | Rutaceae | Citrus aurantium L. var. amara | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Citrus sudachi | Ref. |
Plantae | Rutaceae | Citrus unshiu Markovich | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
Organism | Hamelia patens | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 317,Flavanones and dihydroflavonols
Mizelle,Alalyt.Biochem.,12,(1965),316 |
---|
|