Name |
Vitamin B3 Nicotinic acid Niacin |
Formula |
C6H5NO2 |
Mw |
123.03202841 |
CAS RN |
59-67-6 |
C_ID |
C00000208
,
|
InChIKey |
PVNIIMVLHYAWGP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
SMILES |
c1cncc(c1)C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
-- | Bangiaceae | Porphyra tenera | Ref. |
Animalia | Bombycidae | Bombyx mori | Ref. |
Animalia | Bovidae | Bos taurus domesticus | Ref. |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Fungi | Mortierellaceae | Mortierella vinacea | Ref. |
Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anemarrhenaceae | Anemarrhena asphodeloides | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis | Ref. |
Plantae | Cucurbitaceae | Benincasa hispida | Ref. |
Plantae | Cyprinidae | Cyprinus carpio | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Tamarindus indica | Ref. |
Plantae | Labiatae | Ajuga taiwanensis | Ref. |
Plantae | Lauraceae | Cassytha filiformis | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
- | - | Carpa hircus | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Gallus gallus domesticus | Ref. |
|
|
zoom in
Organism | Colocasia escultenta | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|